Home
Products
Sparteine sulfate pentahydrate
| Product Name | Sparteine sulfate pentahydrate |
| Price: | Inquiry |
| Catalog No.: | CN02149 |
| CAS No.: | 299-39-8 |
| Molecular Formula: | C15H28N2O4S |
| Molecular Weight: | 332.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The herbs of Parochetus communis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C1CC[C@@H]2N(C1)C[C@@H]1C[C@H]2CN2[C@@H]1CCCC2.OS(=O)(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Boiling Point | 340.9ºC at 760mmHg |
| Flash Point | 148.3ºC |
| Exact Mass | 332.176971 |
| PSA | 89.46000 |
| LogP | 2.64890 |
| Vapour Pressure | 2.61E-11mmHg at 25°C |
| Storage condition | -20°C |